Caesium hydrogencarbonate
(Redirected from Cesium hydrogencarbonate)
| Caesium bicarbonate | |
|---|---|
| IUPAC name | Caesium hydrogencarbonate |
| Identifiers | |
| InChI | InChI=1/CH2O3.Cs/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1 |
| InChIKey | ZMCUDHNSHCRDBT-REWHXWOFAQ |
| Standard InChI | InChI=1S/CH2O3.Cs/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1 |
| Standard InChIKey | ZMCUDHNSHCRDBT-UHFFFAOYSA-M |
| CAS number | [] |
| EC number | |
| ChemSpider | |
| Properties[1] | |
| Chemical formula | CsHCO3 |
| Molar mass | 193.92 g/mol |
| Melting point |
175 ºC decomp. |
| Solubility in water | 209.3 g/100 ml (15 ºC) |
| Solubility in ethanol | soluble |
| Hazards | |
| EU index number | not listed |
| Flash point | non-flammable |
| Related compounds | |
| Other anions | Caesium carbonate |
| Other cations | Lithium bicarbonate Sodium bicarbonate Potassium bicarbonate Rubidium bicarbonate |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
Caesium bicarbonate, or caesium hydrogencarbonate is an acid salt of caesium and carbonic acid. It is less hygroscopic than caesium carbonate, and finds use as a base in organic chemistry. It decomposes at 175 ºC to give caesium carbonate:[1]
- 2CsHCO3 → Cs2CO3 + H2O + CO2
References
External links
| Error creating thumbnail: Unable to save thumbnail to destination |
This page is currently licensed under the Creative Commons Attribution 3.0 Unported license and any later versions of that license. |
