Difference between revisions of "P-Anisic acid"
Physchim62 (talk | contribs) (Created page with '{{chembox | Section1={{Chembox Identifiers | CASNo = 100-09-4 | CASNo_Ref = {{cascite}} | EC-number = 202-818-5 | ChemSpiderID = 10181338 | InChI = 1/C8H8O3/c1-11-7-4-…') |
Physchim62 (talk | contribs) (→References) |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{lowercase title}} | ||
{{chembox | {{chembox | ||
| + | | Name = ''p''-Anisic acid | ||
| Section1={{Chembox Identifiers | | Section1={{Chembox Identifiers | ||
| CASNo = 100-09-4 | | CASNo = 100-09-4 | ||
| Line 13: | Line 15: | ||
| Formula = C<sub>8</sub>H<sub>8</sub>O<sub>3</sub> | | Formula = C<sub>8</sub>H<sub>8</sub>O<sub>3</sub> | ||
| MolarMass = 152.15 g/mol | | MolarMass = 152.15 g/mol | ||
| + | }} | ||
| + | | Section7 = {{Chembox Hazards | ||
| + | | EUIndex = not listed | ||
}} | }} | ||
}} | }} | ||
| + | |||
| + | '''''p''-Anisic acid''' is a substituted [[benzoic acid]]. | ||
==References== | ==References== | ||
| Line 20: | Line 27: | ||
{{Unreferenced}} | {{Unreferenced}} | ||
| − | [[Category: | + | {{DEFAULTSORT:Anisic-4 acid}} |
| + | [[Category:Benzoic acids]] | ||
{{CC-BY-3.0}} | {{CC-BY-3.0}} | ||
Latest revision as of 11:15, 22 August 2009
| p-Anisic acid | |
|---|---|
| Identifiers | |
| InChI | InChI=1/C8H8O3/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H,9,10) |
| InChIKey | ZEYHEAKUIGZSGI-UHFFFAOYAA |
| Standard InChI | InChI=1S/C8H8O3/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H,9,10) |
| Standard InChIKey | ZEYHEAKUIGZSGI-UHFFFAOYSA-N |
| CAS number | [] |
| EC number | |
| ChemSpider | |
| Properties | |
| Chemical formula | C8H8O3 |
| Molar mass | 152.15 g/mol |
| Hazards | |
| EU index number | not listed |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
p-Anisic acid is a substituted benzoic acid.
References
| Error creating thumbnail: Unable to save thumbnail to destination |
This page is currently licensed under the Creative Commons Attribution 3.0 Unported license and any later versions of that license. |
