Difference between revisions of "P-Tolyl acetate"
Physchim62 (talk | contribs) |
Physchim62 (talk | contribs) |
||
| Line 2: | Line 2: | ||
{{chembox | {{chembox | ||
| Name = ''p''-Tolyl acetate | | Name = ''p''-Tolyl acetate | ||
| + | | IUPACName = 4-Methylphenyl acetate | ||
| + | | OtherNames = ''p''-Acetoxytoluene | ||
| Section1={{Chembox Identifiers | | Section1={{Chembox Identifiers | ||
| CASNo = 140-39-6 | | CASNo = 140-39-6 | ||
| Line 14: | Line 16: | ||
| Formula = C<sub>9</sub>H<sub>10</sub>O<sub>2</sub> | | Formula = C<sub>9</sub>H<sub>10</sub>O<sub>2</sub> | ||
| MolarMass = 150.17 g/mol | | MolarMass = 150.17 g/mol | ||
| + | }} | ||
| + | | Section7 = {{Chembox Hazards | ||
| + | | EUIndex = not listed | ||
}} | }} | ||
}} | }} | ||
Latest revision as of 15:25, 22 August 2009
| p-Tolyl acetate | |
|---|---|
| IUPAC name | 4-Methylphenyl acetate |
| Other names | p-Acetoxytoluene |
| Identifiers | |
| InChI | InChI=1/C9H10O2/c1-7-3-5-9(6-4-7)11-8(2)10/h3-6H,1-2H3 |
| InChIKey | CDJJKTLOZJAGIZ-UHFFFAOYAR |
| Standard InChI | InChI=1S/C9H10O2/c1-7-3-5-9(6-4-7)11-8(2)10/h3-6H,1-2H3 |
| Standard InChIKey | CDJJKTLOZJAGIZ-UHFFFAOYSA-N |
| CAS number | [] |
| EC number | |
| ChemSpider | |
| Properties | |
| Chemical formula | C9H10O2 |
| Molar mass | 150.17 g/mol |
| Hazards | |
| EU index number | not listed |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
p-Tolyl acetate is an ester of p-cresol and acetic acid.
References
| Error creating thumbnail: Unable to save thumbnail to destination |
This page is currently licensed under the Creative Commons Attribution 3.0 Unported license and any later versions of that license. |
