Difference between revisions of "Caesium acetate"

From WikiChem
Jump to: navigation, search
(Further reading)
(adding refs)
 
(One intermediate revision by the same user not shown)
Line 9: Line 9:
 
|  InChIKey = ZOAIGCHJWKDIPJ-REWHXWOFAB
 
|  InChIKey = ZOAIGCHJWKDIPJ-REWHXWOFAB
 
|  StdInChIKey = ZOAIGCHJWKDIPJ-UHFFFAOYSA-M
 
|  StdInChIKey = ZOAIGCHJWKDIPJ-UHFFFAOYSA-M
|  CASNo = 3396-11-0 <!-- CASRN verified in ESIS -->
+
|  CASNo = 3396-11-0
 
|  EC-number = 222-248-0
 
|  EC-number = 222-248-0
 
|  ChemSpiderID = 141192
 
|  ChemSpiderID = 141192
Line 15: Line 15:
 
   }}
 
   }}
 
| Section2 = {{Chembox Properties
 
| Section2 = {{Chembox Properties
 +
|  Reference = <ref>{{RubberBible62nd|page=B-91}}.</ref>
 
|  C = 2 | H = 3 | Cs = 1 | O = 2
 
|  C = 2 | H = 3 | Cs = 1 | O = 2
 
|  MolarMass = 191.95 g/mol
 
|  MolarMass = 191.95 g/mol
Line 21: Line 22:
 
|  MeltingPtC = 194
 
|  MeltingPtC = 194
 
|  BoilingPtC = 945
 
|  BoilingPtC = 945
|  Solubility = 945.1 g/100 ml (–2.5 °C)
+
|  Solubility = 945.1 g/100 ml (–2.5 °C)<br/>1345.5 g/100 ml (88.5 ºC)
 
   }}
 
   }}
 
| Section7 = {{Chembox Hazards
 
| Section7 = {{Chembox Hazards
Line 28: Line 29:
 
   }}
 
   }}
 
| Section8 = {{Chembox Related
 
| Section8 = {{Chembox Related
|  OtherAnions = [[Caesium propionate]]
+
|  OtherAnions = [[Caesium formate]]
 
|  OtherCations = [[Lithium acetate]]<br/>[[Sodium acetate]]<br/>[[Potassium acetate]]<br/>[[Rubidium acetate]]
 
|  OtherCations = [[Lithium acetate]]<br/>[[Sodium acetate]]<br/>[[Potassium acetate]]<br/>[[Rubidium acetate]]
 
   }}
 
   }}
 
}}
 
}}
  
'''Caesium acetate''' is an [[ion]]ic [[caesium]] compound with the molecular formula CH<sub>3</sub>CO<sub>2</sub>Cs often used in organic synthesis especially in [[Perkin synthesis]]; formation of [[unsaturated]] [[cinnamic acid|cinnamic-type acids]] by the condensation of aromatic [[aldehyde]]s with [[fatty acid]]s.
+
'''Caesium acetate''' is an [[ion]]ic [[caesium]] compound with the molecular formula CH<sub>3</sub>CO<sub>2</sub>Cs often used in organic synthesis especially in [[Perkin synthesis]]; formation of [[unsaturated]] [[cinnamic acid|cinnamic-type acids]] by the condensation of aromatic [[aldehyde]]s with [[fatty acid]]s.<ref>{{citation | first1 = E. | last1 = Koepp | first2 = F. | last2 = Vögtle | journal = Synthesis | year = 1987 | pages = 177}}.</ref>
  
 
==References==
 
==References==
 
{{reflist}}
 
{{reflist}}
{{Unreferenced}}
 
  
 
==Further reading==
 
==Further reading==
 
*{{citation | last1 = Torisawa | first1 = Yasuhiro | last2 = Okabe | first2 = Hiromitsu | last3 = Ikegami | first3 = Shiro | title = Efficient Inversions of Secondary Alcohols using Cesium Acetate and 18-Crown-6 | journal = Chem. Lett. | year = 1984 | volume = 13 | issue = 9 | pages = 1555–56 | doi = 10.1246/cl.1984.1555}}.
 
*{{citation | last1 = Torisawa | first1 = Yasuhiro | last2 = Okabe | first2 = Hiromitsu | last3 = Ikegami | first3 = Shiro | title = Efficient Inversions of Secondary Alcohols using Cesium Acetate and 18-Crown-6 | journal = Chem. Lett. | year = 1984 | volume = 13 | issue = 9 | pages = 1555–56 | doi = 10.1246/cl.1984.1555}}.
*E. Koepp, F. Vögtle; Synthesis (1987) 177.
+
 
 +
==External links==
 +
*[http://www.specialmetals.chemetall.com/pdf/Cesium_Acetate_pure.pdf Caesium acetate factsheet from Chemetall GmbH]
  
 
[[Category:Caesium compounds]]
 
[[Category:Caesium compounds]]

Latest revision as of 09:16, 26 August 2009

Caesium acetate
Cesium acetate.png
IUPAC name Caesium acetate
Other names Cesium acetate
Identifiers
InChI InChI=1/C2H4O2.Cs/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1
InChIKey ZOAIGCHJWKDIPJ-REWHXWOFAB
Standard InChI InChI=1S/C2H4O2.Cs/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1
Standard InChIKey ZOAIGCHJWKDIPJ-UHFFFAOYSA-M
CAS number [3396-11-0]
EC number 222-248-0
ChemSpider 141192
PubChem 160687
Properties[1]
Molecular formula C2H3CsO2
Molar mass 191.95 g mol−1
Appearance colourless solid
Density 2.423 g/cm3, solid
Melting point

194 °C, 467 K, 381 °F

Boiling point

945 °C, 1218 K, 1733 °F

Solubility in water 945.1 g/100 ml (–2.5 °C)
1345.5 g/100 ml (88.5 ºC)
Hazards
EU index number not listed
Flash point non-flammable
Related compounds
Other anions Caesium formate
Other cations Lithium acetate
Sodium acetate
Potassium acetate
Rubidium acetate
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa)

Caesium acetate is an ionic caesium compound with the molecular formula CH3CO2Cs often used in organic synthesis especially in Perkin synthesis; formation of unsaturated cinnamic-type acids by the condensation of aromatic aldehydes with fatty acids.[2]

References

  1. CRC Handbook of Chemistry and Physics, 62nd ed.; Weast, Robert C., Ed.; CRC Press: Boca Raton, FL, 1981; p B-91. ISBN 0-8493-0462-8.
  2. Koepp, E.; Vögtle, F. Synthesis 1987, 177.

Further reading

External links

Error creating thumbnail: Unable to save thumbnail to destination
Wikipedia-logo.png This page was originally imported from Wikipedia, specifically this version of the article "Caesium acetate". Please see the history page on Wikipedia for the original authors. This WikiChem article may have been modified since it was imported. It is licensed under the Creative Commons Attribution–Share Alike 3.0 Unported license.