Difference between revisions of "Caesium acetate"
Physchim62 (talk | contribs) |
Physchim62 (talk | contribs) (adding refs) |
||
| Line 9: | Line 9: | ||
| InChIKey = ZOAIGCHJWKDIPJ-REWHXWOFAB | | InChIKey = ZOAIGCHJWKDIPJ-REWHXWOFAB | ||
| StdInChIKey = ZOAIGCHJWKDIPJ-UHFFFAOYSA-M | | StdInChIKey = ZOAIGCHJWKDIPJ-UHFFFAOYSA-M | ||
| − | | CASNo = 3396-11-0 | + | | CASNo = 3396-11-0 |
| EC-number = 222-248-0 | | EC-number = 222-248-0 | ||
| ChemSpiderID = 141192 | | ChemSpiderID = 141192 | ||
| Line 15: | Line 15: | ||
}} | }} | ||
| Section2 = {{Chembox Properties | | Section2 = {{Chembox Properties | ||
| + | | Reference = <ref>{{RubberBible62nd|page=B-91}}.</ref> | ||
| C = 2 | H = 3 | Cs = 1 | O = 2 | | C = 2 | H = 3 | Cs = 1 | O = 2 | ||
| MolarMass = 191.95 g/mol | | MolarMass = 191.95 g/mol | ||
| Line 21: | Line 22: | ||
| MeltingPtC = 194 | | MeltingPtC = 194 | ||
| BoilingPtC = 945 | | BoilingPtC = 945 | ||
| − | | Solubility = 945.1 g/100 ml (–2.5 °C) | + | | Solubility = 945.1 g/100 ml (–2.5 °C)<br/>1345.5 g/100 ml (88.5 ºC) |
}} | }} | ||
| Section7 = {{Chembox Hazards | | Section7 = {{Chembox Hazards | ||
| Line 33: | Line 34: | ||
}} | }} | ||
| − | '''Caesium acetate''' is an [[ion]]ic [[caesium]] compound with the molecular formula CH<sub>3</sub>CO<sub>2</sub>Cs often used in organic synthesis especially in [[Perkin synthesis]]; formation of [[unsaturated]] [[cinnamic acid|cinnamic-type acids]] by the condensation of aromatic [[aldehyde]]s with [[fatty acid]]s. | + | '''Caesium acetate''' is an [[ion]]ic [[caesium]] compound with the molecular formula CH<sub>3</sub>CO<sub>2</sub>Cs often used in organic synthesis especially in [[Perkin synthesis]]; formation of [[unsaturated]] [[cinnamic acid|cinnamic-type acids]] by the condensation of aromatic [[aldehyde]]s with [[fatty acid]]s.<ref>{{citation | first1 = E. | last1 = Koepp | first2 = F. | last2 = Vögtle | journal = Synthesis | year = 1987 | pages = 177}}.</ref> |
==References== | ==References== | ||
{{reflist}} | {{reflist}} | ||
| − | |||
==Further reading== | ==Further reading== | ||
*{{citation | last1 = Torisawa | first1 = Yasuhiro | last2 = Okabe | first2 = Hiromitsu | last3 = Ikegami | first3 = Shiro | title = Efficient Inversions of Secondary Alcohols using Cesium Acetate and 18-Crown-6 | journal = Chem. Lett. | year = 1984 | volume = 13 | issue = 9 | pages = 1555–56 | doi = 10.1246/cl.1984.1555}}. | *{{citation | last1 = Torisawa | first1 = Yasuhiro | last2 = Okabe | first2 = Hiromitsu | last3 = Ikegami | first3 = Shiro | title = Efficient Inversions of Secondary Alcohols using Cesium Acetate and 18-Crown-6 | journal = Chem. Lett. | year = 1984 | volume = 13 | issue = 9 | pages = 1555–56 | doi = 10.1246/cl.1984.1555}}. | ||
| − | * | + | |
| + | ==External links== | ||
| + | *[http://www.specialmetals.chemetall.com/pdf/Cesium_Acetate_pure.pdf Caesium acetate factsheet from Chemetall GmbH] | ||
[[Category:Caesium compounds]] | [[Category:Caesium compounds]] | ||
Latest revision as of 09:16, 26 August 2009
| Caesium acetate | |
|---|---|
| |
| IUPAC name | Caesium acetate |
| Other names | Cesium acetate |
| Identifiers | |
| InChI | InChI=1/C2H4O2.Cs/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1 |
| InChIKey | ZOAIGCHJWKDIPJ-REWHXWOFAB |
| Standard InChI | InChI=1S/C2H4O2.Cs/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1 |
| Standard InChIKey | ZOAIGCHJWKDIPJ-UHFFFAOYSA-M |
| CAS number | [] |
| EC number | |
| ChemSpider | |
| PubChem | |
| Properties[1] | |
| Molecular formula | C2H3CsO2 |
| Molar mass | 191.95 g mol−1 |
| Appearance | colourless solid |
| Density | 2.423 g/cm3, solid |
| Melting point |
194 °C, 467 K, 381 °F |
| Boiling point |
945 °C, 1218 K, 1733 °F |
| Solubility in water | 945.1 g/100 ml (–2.5 °C) 1345.5 g/100 ml (88.5 ºC) |
| Hazards | |
| EU index number | not listed |
| Flash point | non-flammable |
| Related compounds | |
| Other anions | Caesium formate |
| Other cations | Lithium acetate Sodium acetate Potassium acetate Rubidium acetate |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
Caesium acetate is an ionic caesium compound with the molecular formula CH3CO2Cs often used in organic synthesis especially in Perkin synthesis; formation of unsaturated cinnamic-type acids by the condensation of aromatic aldehydes with fatty acids.[2]
References
Further reading
- Torisawa, Yasuhiro; Okabe, Hiromitsu; Ikegami, Shiro Efficient Inversions of Secondary Alcohols using Cesium Acetate and 18-Crown-6. Chem. Lett. 1984, 13 (9), 1555–56. DOI: 10.1246/cl.1984.1555.
External links
| Error creating thumbnail: Unable to save thumbnail to destination |  |
This page was originally imported from Wikipedia, specifically this version of the article "Caesium acetate". Please see the history page on Wikipedia for the original authors. This WikiChem article may have been modified since it was imported. It is licensed under the Creative Commons Attribution–Share Alike 3.0 Unported license. |
