Difference between revisions of "Caesium carbonate"

From WikiChem
Jump to: navigation, search
(Imported from http://en.wikipedia.org/w/index.php?title=Caesium_carbonate&oldid=290440694)
 
(refs)
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
{{chembox
 
{{chembox
 
| ImageFile = Caesium carbonate.jpg
 
| ImageFile = Caesium carbonate.jpg
−
| ImageSize =
 
 
| IUPACName = Caesium carbonate
 
| IUPACName = Caesium carbonate
−
| OtherNames = Cesium carbonate
+
|   OtherNames = Cesium carbonate
 
| Section1 = {{Chembox Identifiers
 
| Section1 = {{Chembox Identifiers
 +
|  InChI = 1/CH2O3.2Cs/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2
 +
|  StdInChI = 1S/CH2O3.2Cs/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2
 +
|  InChIKey = FJDQFPXHSGXQBY-NUQVWONBAO
 +
|  StdInChIKey = FJDQFPXHSGXQBY-UHFFFAOYSA-L
 
|  CASNo = 534-17-8
 
|  CASNo = 534-17-8
 
|    CASNo_Ref = {{cascite}}
 
|    CASNo_Ref = {{cascite}}
−
|  EINECS =
+
|  EC-number = 208-591-9
−
|  PubChem =
+
|  ChemSpiderID = 10339
−
|  InChI =
 
−
|  RTECS =
 
 
   }}
 
   }}
 
| Section2 = {{Chembox Properties
 
| Section2 = {{Chembox Properties
−
| Formula = Cs<sub>2</sub>CO<sub>3</sub>
+
|   Reference = <ref>{{RubberBible62nd|page=B-91}}.</ref>
−
| MolarMass = 325.82 g/mol
+
|  Formula = Cs<sub>2</sub>CO<sub>3</sub>
−
| Appearance = white powder
+
|   MolarMass = 325.82 g/mol
−
| Density = 4.072 g/cm<sup>3</sup>
+
|   Appearance = white powder
−
| MeltingPt = 610 °C
+
|   Density = 4.072 g/cm<sup>3</sup>
−
| Melting_notes = [[Decomposition|decomp.]]
+
|   MeltingPt = 610 °C decomp.
−
| Solubility = 260.5 g/100 mL (15 °C)
+
|   Solubility = 260.5 g/100 mL (15 °C)
−
| SolubleOther =
+
|   Solubility1 = 11 g/100 ml
−
| Solvent =
+
|   Solvent1 = ethanol
−
| pKa =
+
|   Solubility2 = soluble
−
| pKb =
+
|   Solvent2 = diethyl ether
 
   }}
 
   }}
 
| Section7 = {{Chembox Hazards
 
| Section7 = {{Chembox Hazards
−
| ExternalMSDS =
+
|   ExternalMSDS =
−
| EUIndex = Not listed
+
|   EUIndex = not listed
−
| MainHazards =
+
|   FlashPt = non-flammable
−
| NFPA-H =
 
−
| NFPA-F =
 
−
| NFPA-R =
 
−
| NFPA-O =
 
−
| RPhrases =
 
−
| SPhrases =
 
−
| FlashPt = Non-flammable
 
−
| PEL =
 
 
   }}
 
   }}
 
| Section8 = {{Chembox Related
 
| Section8 = {{Chembox Related
 +
|  OtherAnions = [[Caesium bicarbonate]]
 
|  OtherCations = [[Lithium carbonate]]<br/>[[Sodium carbonate]]<br/>[[Potassium carbonate]]<br/>[[Rubidium carbonate]]
 
|  OtherCations = [[Lithium carbonate]]<br/>[[Sodium carbonate]]<br/>[[Potassium carbonate]]<br/>[[Rubidium carbonate]]
 
   }}
 
   }}
 
}}
 
}}
−
'''Caesium carbonate''' (or '''cesium carbonate''' in the US) is a white crystalline [[solid]] of formula Cs<sub>2</sub>CO<sub>3</sub>.  It is more soluble in organic solvents than many other carbonates such as [[potassium carbonate]], and therefore finds use as a [[base (chemistry)|base]] in [[organic chemistry]].<br/>
 
  
−
Characteristic of carbonate salts, it reacts with protic acids to give carbon dioxide gas, water, and a caesium salt as follows:<br/>
+
'''Caesium carbonate''' is a white crystalline [[solid]] of formula Cs<sub>2</sub>CO<sub>3</sub>.  It is more soluble in organic solvents than many other carbonates such as [[potassium carbonate]], and therefore finds use as a [[base (chemistry)|base]] in [[organic chemistry]].
  
−
<center>Cs<sub>2</sub>CO<sub>3</sub> + 2HCl -> 2CsCl + H<sub>2</sub>O + CO<sub>2</sub></center>
+
Characteristic of carbonate salts, it reacts with protic acids to give carbon dioxide gas, water, and a caesium salt as follows:
 +
:Cs<sub>2</sub>CO<sub>3</sub> + 2HCl &rarr; 2CsCl + H<sub>2</sub>O + CO<sub>2</sub>
 +
 
 +
==References==
 +
{{reflist}}
 +
 
 +
==Further reading==
 +
*{{citation | last1 = Crich | first1 = David | last2 = Banerjee | first2 = Abhisek | title = Expedient synthesis of ''threo''-β-hydroxy-α-amino acid derivatives: phenylalanine, tyrosine, histidine, and tryptophan | journal = J. Org. Chem. | year = 2006 | volume = 71 | issue = 18 | pages = 7106–9 | doi = 10.1021/jo061159i}}.
 +
 
 +
==External links==
 +
*{{OrgSynth preps|id=49137|name=caesium carbonate}}
 +
*[http://www.specialmetals.chemetall.com/pdf/Cesium_Carbonate_999.pdf Caesium carbonate factsheet from Chemetall GmbH]
  
 
[[Category:Caesium compounds]]
 
[[Category:Caesium compounds]]

Latest revision as of 09:23, 26 August 2009

Caesium carbonate
Caesium carbonate.jpg
IUPAC name Caesium carbonate
Other names Cesium carbonate
Identifiers
InChI InChI=1/CH2O3.2Cs/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2
InChIKey FJDQFPXHSGXQBY-NUQVWONBAO
Standard InChI InChI=1S/CH2O3.2Cs/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2
Standard InChIKey FJDQFPXHSGXQBY-UHFFFAOYSA-L
CAS number [534-17-8]
EC number 208-591-9
ChemSpider 10339
Properties[1]
Chemical formula Cs2CO3
Molar mass 325.82 g/mol
Appearance white powder
Density 4.072 g/cm3
Melting point

610 °C decomp.

Solubility in water 260.5 g/100 mL (15 °C)
Solubility in ethanol 11 g/100 ml
Solubility in diethyl ether soluble
Hazards
EU index number not listed
Flash point non-flammable
Related compounds
Other anions Caesium bicarbonate
Other cations Lithium carbonate
Sodium carbonate
Potassium carbonate
Rubidium carbonate
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa)

Caesium carbonate is a white crystalline solid of formula Cs2CO3. It is more soluble in organic solvents than many other carbonates such as potassium carbonate, and therefore finds use as a base in organic chemistry.

Characteristic of carbonate salts, it reacts with protic acids to give carbon dioxide gas, water, and a caesium salt as follows:

Cs2CO3 + 2HCl → 2CsCl + H2O + CO2

References

  1. ↑ CRC Handbook of Chemistry and Physics, 62nd ed.; Weast, Robert C., Ed.; CRC Press: Boca Raton, FL, 1981; p B-91. ISBN 0-8493-0462-8.

Further reading

External links

Error creating thumbnail: Unable to save thumbnail to destination
 Wikipedia-logo.png This page was originally imported from Wikipedia, specifically this version of the article "Caesium carbonate". Please see the history page on Wikipedia for the original authors. This WikiChem article may have been modified since it was imported. It is licensed under the Creative Commons Attribution–Share Alike 3.0 Unported license.
Retrieved from "https://wiki.potsdam.edu/wikichem/index.php?title=Caesium_carbonate&oldid=6975"