Difference between revisions of "3-Methylpentan-1-ol"
Physchim62 (talk | contribs) (Created page with '{{chembox | Name = 3-Methylpentan-1-ol | IUPACName = 3-Methylpentan-1-ol | OtherNames = 3-Methyl-1-pentanol | Section1 = {{Chembox Identifiers | InChI = 1/C6H14O/c1-3-6(2)4-5…') |
Physchim62 (talk | contribs) |
||
| Line 23: | Line 23: | ||
| Section7 = {{Chembox Hazards | | Section7 = {{Chembox Hazards | ||
| EUIndex = not listed | | EUIndex = not listed | ||
| + | }} | ||
| + | | Section8 = {{Chembox Related | ||
| + | | OtherCpds = [[2-Methylpentan-1-ol]]<br/>[[4-Methylpentan-1-ol]] | ||
}} | }} | ||
}} | }} | ||
Latest revision as of 05:06, 3 September 2009
| 3-Methylpentan-1-ol | |
|---|---|
| IUPAC name | 3-Methylpentan-1-ol |
| Other names | 3-Methyl-1-pentanol |
| Identifiers | |
| InChI | InChI=1/C6H14O/c1-3-6(2)4-5-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | IWTBVKIGCDZRPL-UHFFFAOYAP |
| Standard InChI | InChI=1S/C6H14O/c1-3-6(2)4-5-7/h6-7H,3-5H2,1-2H3 |
| Standard InChIKey | IWTBVKIGCDZRPL-UHFFFAOYSA-N |
| CAS number | [] |
| EC number | |
| ChemSpider | |
| Properties[1] | |
| Chemical formula | C6H14O |
| Molar mass | 102.17 g/mol |
| Density | 0.8242 g/cm3 (20 ºC) |
| Boiling point |
152.4 °C |
| Refractive index (nD) | 1.4112 (20 ºC) |
| Hazards | |
| EU index number | not listed |
| Related compounds | |
| Other compounds | 2-Methylpentan-1-ol 4-Methylpentan-1-ol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
References
- ↑ CRC Handbook of Chemistry and Physics, 62nd ed.; Weast, Robert C., Ed.; CRC Press: Boca Raton, FL, 1981; p C-419. ISBN 0-8493-0462-8.
| Error creating thumbnail: Unable to save thumbnail to destination |
This page is currently licensed under the Creative Commons Attribution 3.0 Unported license and any later versions of that license. |
