Difference between revisions of "Iodine pentoxide"
Physchim62 (talk | contribs) (Created page with ''''Iodine pentoxide''', I<sub>2</sub>O<sub>5</sub> is the most stable of the oxides of iodine. It is a white solid that is very hygroscopic. It is formed by direct re…') |
Physchim62 (talk | contribs) |
||
| Line 1: | Line 1: | ||
| − | '''Iodine pentoxide''', I<sub>2</sub>O<sub>5</sub> is the most stable of the [[oxide]]s of [[iodine]]. It is a white solid that is very [[hygroscopic]]. It is formed by direct reaction of the elements in a glow discharge, but is most conveniently prepared by dehydrating [[iodic acid]] at 200 °C. | + | {{chembox |
| + | | IUPACName = diiodine pentaoxide | ||
| + | | OtherNames = iodic anhydride | ||
| + | | Section1 = {{Chembox Identifiers | ||
| + | | CASNo = 12029-98-0 | ||
| + | | EINECS = 234-740-2 | ||
| + | | ChemSpiderID = 140179 | ||
| + | | InChI = InChI=1S/I2O5/c3-1(4)7-2(5)6 | ||
| + | }} | ||
| + | | Section2 = {{Chembox Properties | ||
| + | | Reference = <ref>{{RubberBible62nd|page=B-107}}.</ref> | ||
| + | | Formula = I<sub>2</sub>O<sub>5</sub> | ||
| + | | MolarMass = 333.81 g mol<sup>−1</sup> | ||
| + | | Appearance = white solid | ||
| + | | Density = 4.799 g cm<sup>−3</sup> | ||
| + | | MeltingPt = 300 °C ''decomp'' | ||
| + | | Solubility = reacts | ||
| + | | SolubleOther = | ||
| + | | Solvent = | ||
| + | }} | ||
| + | | Section3 = {{Chembox Structure | ||
| + | | Reference = <ref>{{citation | title = Iodine Oxide. Part III. The Crystal Structure of I<sub>2</sub>O<sub>5</sub> | last1 = Selte | first1 = Kari | last2 = Kjekshus | first2 = Arne | journal = Acta Chem. Scand. | year = 1970 | volume = 24 | issue = 6 | pages = 1912–24 | doi = 10.3891/acta.chem.scand.24-1912}}.</ref> | ||
| + | | SpaceGroup = P2<sub>1</sub>/''c'' | ||
| + | | Coordination = distorted square-pyramidal (I) | ||
| + | | LattConst_a = 1103.6(3) pm | ||
| + | | LattConst_b = 506.3(1) pm | ||
| + | | LattConst_c = 813.5(2) pm | ||
| + | | LattConst_beta = 107.18(2) | ||
| + | }} | ||
| + | | Section7 = {{Chembox Hazards | ||
| + | | ExternalMSDS = | ||
| + | | EUIndex = not listed | ||
| + | | FlashPt = non-flammable | ||
| + | }} | ||
| + | | Section8 = {{Chembox Related | ||
| + | | OtherCpds = [[Iodic acid]] | ||
| + | }} | ||
| + | }} | ||
| + | '''Iodine pentoxide''', I<sub>2</sub>O<sub>5</sub>, is the most stable of the [[oxide]]s of [[iodine]]: it was first prepared in 1813 by (independently) [[Joseph-Louis Gay-Lussac|Gay-Lussac]] and [[Humphrey Davy|Davy]].<ref name="G&E">{{Greenwood&Earnshaw1st|pages=997–99}}.</ref> It is a white solid that is very [[hygroscopic]]. It is formed by direct reaction of the elements in a glow discharge, but is most conveniently prepared by dehydrating [[iodic acid]] at 200 °C. Above 300 °C, it decomposes to the elements.<ref name="G&E"/> | ||
==Notes and references== | ==Notes and references== | ||
Revision as of 11:48, 10 September 2010
| Iodine pentoxide | |
|---|---|
| IUPAC name | diiodine pentaoxide |
| Other names | iodic anhydride |
| Identifiers | |
| InChI | InChI=InChI=1S/I2O5/c3-1(4)7-2(5)6 |
| CAS number | [] |
| EC number | |
| ChemSpider | |
| Properties[1] | |
| Chemical formula | I2O5 |
| Molar mass | 333.81 g mol−1 |
| Appearance | white solid |
| Density | 4.799 g cm−3 |
| Melting point |
300 °C decomp |
| Solubility in water | reacts |
| Structure[2] | |
| Space group | P21/c |
| Lattice constant | a = 1103.6(3) pm, b = 506.3(1) pm, c = 813.5(2) pm, α = 90°, β = 107.18(2)°, γ = 90° |
| Coordination geometry | distorted square-pyramidal (I) |
| Hazards | |
| EU index number | not listed |
| Flash point | non-flammable |
| Related compounds | |
| Other compounds | Iodic acid |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
Iodine pentoxide, I2O5, is the most stable of the oxides of iodine: it was first prepared in 1813 by (independently) Gay-Lussac and Davy.[3] It is a white solid that is very hygroscopic. It is formed by direct reaction of the elements in a glow discharge, but is most conveniently prepared by dehydrating iodic acid at 200 °C. Above 300 °C, it decomposes to the elements.[3]
Notes and references
Notes
References
- ↑ CRC Handbook of Chemistry and Physics, 62nd ed.; Weast, Robert C., Ed.; CRC Press: Boca Raton, FL, 1981; p B-107. ISBN 0-8493-0462-8.
- ↑ Selte, Kari; Kjekshus, Arne Iodine Oxide. Part III. The Crystal Structure of I2O5. Acta Chem. Scand. 1970, 24 (6), 1912–24. DOI: 10.3891/acta.chem.scand.24-1912.
- ↑ 3.0 3.1 Greenwood, Norman N.; Earnshaw, A. Chemistry of the Elements; Pergamon: Oxford, 1984; pp 997–99. ISBN 0-08-022057-6.
External links
 |
See also the corresponding article on Wikipedia. |
| Error creating thumbnail: Unable to save thumbnail to destination |
This page is currently licensed under the Creative Commons Attribution 3.0 Unported license and any later versions of that license. |
