Difference between revisions of "P-Tolylacetic acid"
Physchim62 (talk | contribs) (Created page with '{{chembox | Section1={{Chembox Identifiers | CASNo = 622-47-9 | EC-number = 210-738-7 | ChemSpiderID = 217532 | InChI = 1/C9H10O2/c1-7-2-4-8(5-3-7)6-9(10)11/h2-5H,6H2,1H3…') |
Physchim62 (talk | contribs) |
||
| Line 1: | Line 1: | ||
| + | {{lowercase title}} | ||
{{chembox | {{chembox | ||
| + | | Name = ''p''-Tolylacetic acid | ||
| Section1={{Chembox Identifiers | | Section1={{Chembox Identifiers | ||
| CASNo = 622-47-9 | | CASNo = 622-47-9 | ||
| Line 12: | Line 14: | ||
| Formula = C<sub>9</sub>H<sub>10</sub>O<sub>2</sub> | | Formula = C<sub>9</sub>H<sub>10</sub>O<sub>2</sub> | ||
| MolarMass = 150.17 g/mol | | MolarMass = 150.17 g/mol | ||
| + | }} | ||
| + | | Section7 = {{Chembox Hazards | ||
| + | | EUIndex = not listed | ||
}} | }} | ||
}} | }} | ||
| + | |||
| + | '''''p''-Tolylacetic acid''' is a [[carboxylic acid]]. | ||
==References== | ==References== | ||
| Line 19: | Line 26: | ||
{{Unreferenced}} | {{Unreferenced}} | ||
| + | {{DEFAULTSORT:Tolylacetic acid-4}} | ||
[[Category:Carboxylic acids]] | [[Category:Carboxylic acids]] | ||
{{CC-BY-3.0}} | {{CC-BY-3.0}} | ||
Latest revision as of 16:17, 22 August 2009
| p-Tolylacetic acid | |
|---|---|
| Identifiers | |
| InChI | InChI=1/C9H10O2/c1-7-2-4-8(5-3-7)6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
| InChIKey | GXXXUZIRGXYDFP-UHFFFAOYAI |
| Standard InChI | InChI=1S/C9H10O2/c1-7-2-4-8(5-3-7)6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
| Standard InChIKey | GXXXUZIRGXYDFP-UHFFFAOYSA-N |
| CAS number | [] |
| EC number | |
| ChemSpider | |
| Properties | |
| Chemical formula | C9H10O2 |
| Molar mass | 150.17 g/mol |
| Hazards | |
| EU index number | not listed |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
p-Tolylacetic acid is a carboxylic acid.
References
| Error creating thumbnail: Unable to save thumbnail to destination |
This page is currently licensed under the Creative Commons Attribution 3.0 Unported license and any later versions of that license. |
