4-Methylpentan-1-ol
Revision as of 05:28, 3 September 2009 by Physchim62 (talk | contribs) (Created page with '{{chembox | Name = 4-Methylpentan-1-ol | IUPACName = 4-Methylpentan-1-ol | OtherNames = 4-Methyl-1-pentanol<br/>Isohexanol<br/>Isohexyl alcohol | Section1 = {{Chembox Identifie…')
| 4-Methylpentan-1-ol | |
|---|---|
| IUPAC name | 4-Methylpentan-1-ol |
| Other names | 4-Methyl-1-pentanol Isohexanol Isohexyl alcohol |
| Identifiers | |
| InChI | InChI=1/C6H14O/c1-6(2)4-3-5-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | PCWGTDULNUVNBN-UHFFFAOYAC |
| Standard InChI | InChI=1S/C6H14O/c1-6(2)4-3-5-7/h6-7H,3-5H2,1-2H3 |
| Standard InChIKey | PCWGTDULNUVNBN-UHFFFAOYSA-N |
| CAS number | [] |
| EC number | |
| ChemSpider | |
| Properties[1] | |
| Chemical formula | C6H14O |
| Molar mass | 102.17 g/mol |
| Density | 0.8131 g/cm3 (20 ºC) |
| Boiling point |
151.6 °C |
| Refractive index (nD) | 1.4134 (20 ºC) |
| Hazards | |
| EU index number | not listed |
| Related compounds | |
| Other primary hexanols | Hexan-1-ol 2-Methylpentan-1-ol 3-Methylpentan-1-ol 3,3-Dimethylbutan-1-ol |
| Other compounds | 4-Methylpentanal 4-Methylpentanoic acid |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
References
- ↑ CRC Handbook of Chemistry and Physics, 62nd ed.; Weast, Robert C., Ed.; CRC Press: Boca Raton, FL, 1981; p C-419. ISBN 0-8493-0462-8.
| Error creating thumbnail: Unable to save thumbnail to destination |
This page is currently licensed under the Creative Commons Attribution 3.0 Unported license and any later versions of that license. |
