Difference between revisions of "Potassium iodate"
Physchim62 (talk | contribs) (Created page with ''''Potassium iodate''', KIO<sub>3</sub>, is a common iodine compound. ==Notes and references== ===Notes=== {{reflist|group=Note}} ===References=== {{reflist}} ==External l…') |
Physchim62 (talk | contribs) |
||
(15 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | '''Potassium iodate''', KIO<sub>3</sub>, is a common [[iodine]] compound. | + | {{FixBunching|beg}} |
+ | {{chembox | ||
+ | | IUPACName = potassium iodate | ||
+ | | Section1 = {{Chembox Identifiers | ||
+ | | CASNo = 7758-05-6 | ||
+ | | CASNo_Ref = {{cascite}} | ||
+ | | ChemSpiderID = 22856 | ||
+ | | InChI=1/HIO3.K/c2-1(3)4;/h(H,2,3,4);/q;+1/p-1 | ||
+ | | StdInChI=1S/HIO3.K/c2-1(3)4;/h(H,2,3,4);/q;+1/p-1 | ||
+ | | InChIKey = JLKDVMWYMMLWTI-REWHXWOFAL | ||
+ | | StdInChIKey = JLKDVMWYMMLWTI-UHFFFAOYSA-M | ||
+ | | EC-number = 231-831-9 | ||
+ | }} | ||
+ | | Section2 = {{Chembox Properties | ||
+ | | Reference = <ref name="RubberBible">{{RubberBible62nd|page=B-133}}.</ref> | ||
+ | | Formula = KIO<sub>3</sub> | ||
+ | | MolarMass = 214.00 g mol<sup>−1</sup> | ||
+ | | Appearance = white crystals | ||
+ | | Density = 3.93 g cm<sup>−3</sup> | ||
+ | | Solubility = 4.74 g/100 ml (0 °C) | ||
+ | }} | ||
+ | | Section3 = {{Chembox Structure | ||
+ | | Reference = <ref>{{citation | journal = Acta Crystallogr., Sect. C: Cryst. Struct. Commun. | year = 1985 | volume = C41 | pages = 1388–91 | doi = 10.1107/S0108270185007880 | title = Structure (neutron) of potassium iodate at 100 and 10 K | first = B. W. | last = Lucas}}.</ref> | ||
+ | | SpaceGroup = P1 (No. 1) | ||
+ | | Coordination = | ||
+ | | LattConst_a = 769.82(4) pm | ||
+ | | LattConst_b = 765.97(2) pm | ||
+ | | LattConst_c = 769.12(5) pm | ||
+ | | LattConst_alpha = 108.999(5) | ||
+ | | LattConst_beta = 109.745(2) | ||
+ | | LattConst_gamma = 109.085(5) | ||
+ | }} | ||
+ | | Section7 = {{Chembox Hazards | ||
+ | | Reference = <ref>{{GHS class NZ|id=1913|accessdate=2010-09-09}}.</ref> | ||
+ | | ExternalMSDS = | ||
+ | | EUIndex = not listed | ||
+ | | GHSPictograms = {{GHS03|Ox. Sol. 2}}{{GHS07|Acute Tox. 4 (oral)}} | ||
+ | | GHSSignalWord = DANGER | ||
+ | | HPhrases = {{H-phrases|272|302}} | ||
+ | | PPhrases = {{P-phrases|210|220|221|264|270|280|301+312|330|370+378|501}} | ||
+ | | FlashPt = Non-flammable | ||
+ | }} | ||
+ | | Section8 = {{Chembox Related | ||
+ | | OtherAnions = [[Potassium iodide]]<br/>[[Potassium periodate]] | ||
+ | | OtherCations = [[Lithium iodate]]<br/>[[Sodium iodate]]<br/>[[Rubidium iodate]]<br/>[[Caesium iodate]] | ||
+ | | OtherCpds = [[Potassium biiodate]] | ||
+ | }} | ||
+ | }} | ||
+ | '''Potassium iodate''', KIO<sub>3</sub>, is a common [[iodine]] compound. It is used for the prophylaxis of [[iodine deficiency]],<ref>{{citation | journal = Lancet | volume = 295 | pages = 489–92 | year = 1970 | doi = 10.1016/S0140-6736(70)91578-3 | title = Goitre Prophylaxis by Addition of Potassium Iodate to Bread | first1 = F. W. | last1 = Clements | first2 = H. B. | last2 = Gibson | first3 = J. F. | last3 = Howeler-Coy}}.</ref><ref>{{citation | title = Assessment of the iodine concentration in table salt at the production stage in South Africa | first = Pieter L. | last = Jooste | journal = Bull. W. H. O. | year = 2003 | volume = 81 | issue = 7 | pages = 517–21 | url = http://whqlibdoc.who.int/bulletin/2003/Vol81-No7/bulletin_2003_81%287%29_517-521.pdf}}.</ref> in [[radiological protection]]<ref>{{citation | title = Potassium Iodate and Its Comparison to Potassium Iodide As a Blocker of <sup>131</sup>I Uptake by the Thyroid in Rats | last1 = Pahuja | first1 = D. N. | last2 = Rajan | first2 = M. G. R. | last3 = Borkar | first3 = A. V. | last4 = Samuel | first4 = A. M. | journal = Health Phys. | year = 1993 | volume = 65 | issue = 5 | pages = 545–49 | doi = 10.1097/00004032-199311000-00014}}.</ref> and in [[analytical chemistry]]. It has also been used as a [[flour treatment agent]],<ref>{{citation | inventor1-last = Endo | inventor1-first = Shigeru | inventor2-last = Negishi | inventor2-first = Yoshie | inventor3-last = Shiiba | inventor3-first Kiwamu | assignee = Nisshin Flour Milling Co. | title = New modified gluten product and bread improver composition | country-code = US | patent-number = 4871577 | issue-date = 1989-10-03}}.</ref> although this is no longer recommended. | ||
+ | |||
+ | ==Preparation== | ||
+ | Potassium iodate is commercially available in both reagent and analytical grades. It may be prepared by the reaction of elemental [[iodine]] with a concentrated aqueous solution of [[potassium hydroxide]]: at appropriate concentrations, the potassium iodate will precipitate leaving the by-product [[potassium iodide]] in solution.<ref>{{citation | inventor-last = Behrman | inventor-first = Abraham Sidney | title = Process for the preparation of iodides | country-code = US | patent-number = 2800390 | issue-date = 1957-07-23}}.</ref> | ||
+ | :I<sub>2</sub> + 6 KOH → KIO<sub>3</sub> + 5 KI + 3 H<sub>2</sub>O | ||
+ | Potassium iodate can also be prepared by the high-pressure oxidation of KI with [[oxygen]] at 600 °C or by the reaction of elemental iodine with [[potassium chlorate]].<ref>{{Greenwood&Earnshaw1st|page=1010}}.</ref> | ||
+ | :2 KI + 3 O<sub>2</sub> → 2 KIO<sub>3</sub> | ||
+ | :I<sub>2</sub> + 2 KClO<sub>3</sub> → 2 KIO<sub>3</sub> + Cl<sub>2</sub> | ||
+ | |||
+ | ==Applications== | ||
+ | ===Uses in food=== | ||
+ | |||
+ | ===Radiological protection=== | ||
+ | |||
+ | ===Analytical uses=== | ||
==Notes and references== | ==Notes and references== | ||
Line 10: | Line 72: | ||
==External links== | ==External links== | ||
{{wikipedia|Potassium iodate}} | {{wikipedia|Potassium iodate}} | ||
+ | *{{JECFA-summary|url=http://www.inchem.org/documents/jecfa/jeceval/jec_1983.htm}} | ||
+ | *{{JECFA-mono|url=http://www.inchem.org/documents/jecfa/jecmono/v024je11.htm|whoseries=24|title=Iodine}} | ||
[[Category:Potassium compounds]] | [[Category:Potassium compounds]] | ||
[[Category:Iodates]] | [[Category:Iodates]] | ||
+ | [[Category:Flour treatment agents]] | ||
{{CC-BY-3.0}} | {{CC-BY-3.0}} |
Latest revision as of 21:49, 12 September 2010
Potassium iodate, KIO3, is a common iodine compound. It is used for the prophylaxis of iodine deficiency,[4][5] in radiological protection[6] and in analytical chemistry. It has also been used as a flour treatment agent,[7] although this is no longer recommended. ContentsPreparationPotassium iodate is commercially available in both reagent and analytical grades. It may be prepared by the reaction of elemental iodine with a concentrated aqueous solution of potassium hydroxide: at appropriate concentrations, the potassium iodate will precipitate leaving the by-product potassium iodide in solution.[8]
Potassium iodate can also be prepared by the high-pressure oxidation of KI with oxygen at 600 °C or by the reaction of elemental iodine with potassium chlorate.[9]
ApplicationsUses in foodRadiological protectionAnalytical usesNotes and referencesNotesReferences
External links
|