Difference between revisions of "Hexan-3-ol"
Physchim62 (talk | contribs) (Created page with '{{chembox | Name = Hexan-3-ol | IUPACName = Hexan-3-ol | OtherNames = 3-Hexanol | Section1 = {{Chembox Identifiers | InChI = 1/C6H14O/c1-3-5-6(7)4-2/h6-7H,3-5H2,1-2H3 | Std…') |
Physchim62 (talk | contribs) |
||
| Line 11: | Line 11: | ||
| EC-number = 210-790-0 | | EC-number = 210-790-0 | ||
| ChemSpiderID = 11678 | | ChemSpiderID = 11678 | ||
| + | }} | ||
| + | | Section2 = {{Chembox Properties | ||
| + | | Reference = <ref>{{RubberBible62nd|page=C-330}}.</ref> | ||
| + | | Formula = C<sub>6</sub>H<sub>14</sub>O | ||
| + | | MolarMass = 102.17 g/mol | ||
| + | | Density = 0.8182 g/cm<sup>3</sup> (20 ºC) | ||
| + | | MeltingPt = | ||
| + | | BoilingPt = 135 °C | ||
| + | | RefractIndex = 1.4167 (20 ºC) | ||
| + | }} | ||
| + | | Section7 = {{Chembox Hazards | ||
| + | | Reference = <ref>{{GHS class NZ|id=1592|accessdate=2009-09-03}}.</ref> | ||
| + | | EUIndex = not listed | ||
| + | | GHSPictograms = {{GHS flame|Flam. Liq. 3}} | ||
| + | | GHSSignalWord = WARNING | ||
| + | | HPhrases = {{H-phrases|226}} | ||
| + | | PPhrases = {{P-phrases|210|233|240|241|242|243|303+361+353|370+378|403+235|501}} | ||
| + | | FlashPt = 41 ºC (106 ºF) | ||
| + | }} | ||
| + | | Section8 = {{Chembox Related | ||
| + | | OtherFunctn = [[Pentan-3-ol]]<br/>[[Hexan-2-ol]]<br/>[[Heptan-3-ol]] | ||
| + | | Function = secondary [[alcohol]]s | ||
| + | | OtherCpds = [[Hexan-3-one]] | ||
}} | }} | ||
}} | }} | ||
| + | |||
| + | '''Hexan-3-ol''' is a six-carbon straight chain secondary [[alcohol]]. | ||
| + | |||
| + | ==References== | ||
| + | {{reflist}} | ||
| + | |||
| + | {{DEFAULTSORT:Hexanol-3}} | ||
| + | [[Category:Alcohols]] | ||
{{CC-BY-3.0}} | {{CC-BY-3.0}} | ||
Latest revision as of 04:42, 3 September 2009
| Hexan-3-ol | |
|---|---|
| IUPAC name | Hexan-3-ol |
| Other names | 3-Hexanol |
| Identifiers | |
| InChI | InChI=1/C6H14O/c1-3-5-6(7)4-2/h6-7H,3-5H2,1-2H3 |
| InChIKey | ZOCHHNOQQHDWHG-UHFFFAOYAA |
| Standard InChI | InChI=1S/C6H14O/c1-3-5-6(7)4-2/h6-7H,3-5H2,1-2H3 |
| Standard InChIKey | ZOCHHNOQQHDWHG-UHFFFAOYSA-N |
| CAS number | [] |
| EC number | |
| ChemSpider | |
| Properties[1] | |
| Chemical formula | C6H14O |
| Molar mass | 102.17 g/mol |
| Density | 0.8182 g/cm3 (20 ºC) |
| Boiling point |
135 °C |
| Refractive index (nD) | 1.4167 (20 ºC) |
| Hazards[2] | |
| EU index number | not listed |
| GHS pictograms | 
|
| GHS signal word | WARNING |
| GHS hazard statements | H226 |
| GHS precautionary statements | P210, P233, P240, P241, P242, P243, P303+361+353, P370+378, P403+235, P501 |
| Flash point | 41 ºC (106 ºF) |
| Related compounds | |
| Other secondary alcohols | Pentan-3-ol Hexan-2-ol Heptan-3-ol |
| Other compounds | Hexan-3-one |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
Hexan-3-ol is a six-carbon straight chain secondary alcohol.
References
- ↑ CRC Handbook of Chemistry and Physics, 62nd ed.; Weast, Robert C., Ed.; CRC Press: Boca Raton, FL, 1981; p C-330. ISBN 0-8493-0462-8.
- ↑ HSNO Chemical Classification Information Database, <http://www.ermanz.govt.nz/Chemicals/ChemicalDisplay.aspx?SubstanceID=1592> (accessed 3 September 2009), New Zealand Environmental Risk Management Authority.
| Error creating thumbnail: Unable to save thumbnail to destination |
This page is currently licensed under the Creative Commons Attribution 3.0 Unported license and any later versions of that license. |
