Difference between revisions of "Iodine pentoxide"
Physchim62 (talk | contribs) |
Physchim62 (talk | contribs) |
||
| (One intermediate revision by the same user not shown) | |||
| Line 7: | Line 7: | ||
| ChemSpiderID = 140179 | | ChemSpiderID = 140179 | ||
| InChI = InChI=1S/I2O5/c3-1(4)7-2(5)6 | | InChI = InChI=1S/I2O5/c3-1(4)7-2(5)6 | ||
| + | | StdInChI= | ||
| + | | InChIKey = | ||
| + | | StdInChIKey = | ||
}} | }} | ||
| Section2 = {{Chembox Properties | | Section2 = {{Chembox Properties | ||
| Line 21: | Line 24: | ||
| Section3 = {{Chembox Structure | | Section3 = {{Chembox Structure | ||
| Reference = <ref name="Struct">{{citation | title = Iodine Oxide. Part III. The Crystal Structure of I<sub>2</sub>O<sub>5</sub> | last1 = Selte | first1 = Kari | last2 = Kjekshus | first2 = Arne | journal = Acta Chem. Scand. | year = 1970 | volume = 24 | issue = 6 | pages = 1912–24 | doi = 10.3891/acta.chem.scand.24-1912}}.</ref> | | Reference = <ref name="Struct">{{citation | title = Iodine Oxide. Part III. The Crystal Structure of I<sub>2</sub>O<sub>5</sub> | last1 = Selte | first1 = Kari | last2 = Kjekshus | first2 = Arne | journal = Acta Chem. Scand. | year = 1970 | volume = 24 | issue = 6 | pages = 1912–24 | doi = 10.3891/acta.chem.scand.24-1912}}.</ref> | ||
| − | | SpaceGroup = P2<sub>1</sub>/''c'' | + | | SpaceGroup = P2<sub>1</sub>/''c'' (No. 14) |
| Coordination = distorted square-pyramidal (I) | | Coordination = distorted square-pyramidal (I) | ||
| LattConst_a = 1103.6(3) pm | | LattConst_a = 1103.6(3) pm | ||
Latest revision as of 18:16, 10 September 2010
| Iodine pentoxide | |
|---|---|
| IUPAC name | diiodine pentaoxide |
| Other names | iodic anhydride |
| Identifiers | |
| InChI | InChI=InChI=1S/I2O5/c3-1(4)7-2(5)6 |
| CAS number | [] |
| EC number | |
| ChemSpider | |
| Properties[1] | |
| Chemical formula | I2O5 |
| Molar mass | 333.81 g mol−1 |
| Appearance | white solid |
| Density | 4.799 g cm−3 |
| Melting point |
300 °C decomp |
| Solubility in water | reacts |
| Structure[2] | |
| Space group | P21/c (No. 14) |
| Lattice constant | a = 1103.6(3) pm, b = 506.3(1) pm, c = 813.5(2) pm, α = 90°, β = 107.18(2)°, γ = 90° |
| Coordination geometry | distorted square-pyramidal (I) |
| Thermochemistry[3] | |
| Std enthalpy of formation ΔfH |
−158.1 kJ mol−1 |
| Hazards[4] | |
| EU index number | not listed |
| GHS pictograms |  
|
| GHS signal word | DANGER |
| GHS hazard statements | H272, H314, H318 |
| GHS precautionary statements | P210, P220, P221, P260, P264, P280, P301+330+331, P303+361+353, P363, P304+340, P310, P321, P305+351+338, P370+378 |
| Flash point | non-flammable |
| Related compounds | |
| Other compounds | Anhydro-iodic acid Iodic acid |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
Iodine pentoxide, I2O5, is the most stable of the oxides of iodine: it was first prepared in 1813 by (independently) Gay-Lussac and Davy.[3] It is a white solid that is very hygroscopic.[Note 1] It is formed by direct reaction of the elements in a glow discharge, but is most conveniently prepared by dehydrating iodic acid at 200 °C. Above 300 °C, it decomposes to the elements.[3]
Structure
Notes and references
Notes
- ↑ Commercial "I2O5" is said to be essentially anhydro-iodic acid, HI3O8 or HIO3·I2O5.[3]
References
- ↑ CRC Handbook of Chemistry and Physics, 62nd ed.; Weast, Robert C., Ed.; CRC Press: Boca Raton, FL, 1981; p B-107. ISBN 0-8493-0462-8.
- ↑ Selte, Kari; Kjekshus, Arne Iodine Oxide. Part III. The Crystal Structure of I2O5. Acta Chem. Scand. 1970, 24 (6), 1912–24. DOI: 10.3891/acta.chem.scand.24-1912.
- ↑ 3.0 3.1 3.2 3.3 Greenwood, Norman N.; Earnshaw, A. Chemistry of the Elements; Pergamon: Oxford, 1984; pp 997–99. ISBN 0-08-022057-6.
- ↑ HSNO Chemical Classification Information Database, <http://www.ermanz.govt.nz/Chemicals/ChemicalDisplay.aspx?SubstanceID=15707> (accessed 10 September 2010), New Zealand Environmental Risk Management Authority.
External links
 |
See also the corresponding article on Wikipedia. |
| Error creating thumbnail: Unable to save thumbnail to destination |
This page is currently licensed under the Creative Commons Attribution 3.0 Unported license and any later versions of that license. |
