3-Methylbut-3-en-1-ol
Revision as of 13:43, 31 August 2009 by Physchim62 (talk | contribs) (Created page with '{{chembox | Name = 3-Methylbut-3-en-1-ol | IUPACName = 3-Methylbut-3-en-1-ol | OtherNames = Isoprenol | Section1 = {{Chembox Identifiers | InChI = 1/C5H10O/c1-5(2)3-4-6/h6H,1…')
| 3-Methylbut-3-en-1-ol | |
|---|---|
| IUPAC name | 3-Methylbut-3-en-1-ol |
| Other names | Isoprenol |
| Identifiers | |
| InChI | InChI=1/C5H10O/c1-5(2)3-4-6/h6H,1,3-4H2,2H3 |
| InChIKey | CPJRRXSHAYUTGL-UHFFFAOYAD |
| Standard InChI | InChI=1S/C5H10O/c1-5(2)3-4-6/h6H,1,3-4H2,2H3 |
| Standard InChIKey | CPJRRXSHAYUTGL-UHFFFAOYSA-N |
| CAS number | [] |
| EC number | |
| ChemSpider | |
| Properties[1] | |
| Chemical formula | C5H10O |
| Molar mass | 86.132 g/mol |
| Density | 0.853 g/cm3 |
| Boiling point |
130–132 ºC |
| Refractive index (nD) | 1.433 |
| Hazards[2] | |
| EU index number | not listed |
| GHS pictograms |  
|
| GHS signal word | WARNING |
| GHS hazard statements | H226, H319 |
| GHS precautionary statements | P210, P233, P240, P241, P242, P243, P264, P280, P303+361+353, P305+351+338, P337+313, P370+378, P403+235, P501 |
| Flash point | 36 ºC (97 ºF) |
| Related compounds | |
| Other compounds | 3-Methylbut-2-en-1-ol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
References
- ↑ Source: Sigma-Aldrich Co., product no. W519308 (data accessed 2009-08-31).
- ↑ HSNO Chemical Classification Information Database, <http://www.ermanz.govt.nz/Chemicals/ChemicalDisplay.aspx?SubstanceID=13375> (accessed 31 August 2009), New Zealand Environmental Risk Management Authority.
| Error creating thumbnail: Unable to save thumbnail to destination |
This page is currently licensed under the Creative Commons Attribution 3.0 Unported license and any later versions of that license. |
