Hexan-3-ol
| Hexan-3-ol | |
|---|---|
| IUPAC name | Hexan-3-ol |
| Other names | 3-Hexanol |
| Identifiers | |
| InChI | InChI=1/C6H14O/c1-3-5-6(7)4-2/h6-7H,3-5H2,1-2H3 |
| InChIKey | ZOCHHNOQQHDWHG-UHFFFAOYAA |
| Standard InChI | InChI=1S/C6H14O/c1-3-5-6(7)4-2/h6-7H,3-5H2,1-2H3 |
| Standard InChIKey | ZOCHHNOQQHDWHG-UHFFFAOYSA-N |
| CAS number | [] |
| EC number | |
| ChemSpider | |
| Properties[1] | |
| Chemical formula | C6H14O |
| Molar mass | 102.17 g/mol |
| Density | 0.8182 g/cm3 (20 ºC) |
| Boiling point |
135 °C |
| Refractive index (nD) | 1.4167 (20 ºC) |
| Hazards[2] | |
| EU index number | not listed |
| GHS pictograms | 
|
| GHS signal word | WARNING |
| GHS hazard statements | H226 |
| GHS precautionary statements | P210, P233, P240, P241, P242, P243, P303+361+353, P370+378, P403+235, P501 |
| Flash point | 41 ºC (106 ºF) |
| Related compounds | |
| Other secondary alcohols | Pentan-3-ol Hexan-2-ol Heptan-3-ol |
| Other compounds | Hexan-3-one |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
Hexan-3-ol is a six-carbon straight chain secondary alcohol.
References
- ↑ CRC Handbook of Chemistry and Physics, 62nd ed.; Weast, Robert C., Ed.; CRC Press: Boca Raton, FL, 1981; p C-330. ISBN 0-8493-0462-8.
- ↑ HSNO Chemical Classification Information Database, <http://www.ermanz.govt.nz/Chemicals/ChemicalDisplay.aspx?SubstanceID=1592> (accessed 3 September 2009), New Zealand Environmental Risk Management Authority.
| Error creating thumbnail: Unable to save thumbnail to destination |
This page is currently licensed under the Creative Commons Attribution 3.0 Unported license and any later versions of that license. |
